C12H9BrCl3FN2O4 — CID 164904271
methyl 4-bromo-3-fluoro-5-methyl-2-[(2,2,2-trichloroacetyl)carbamoylamino]benzoate (PubChem CID 164904271) has the molecular formula C12H9BrCl3FN2O4 and a molecular weight of 450.48 g/mol. Its IUPAC name is methyl 4-bromo-3-fluoro-5-methyl-2-[(2,2,2-trichloroacetyl)carbamoylamino]benzoate.
| Compound Name | methyl 4-bromo-3-fluoro-5-methyl-2-[(2,2,2-trichloroacetyl)carbamoylamino]benzoate |
|---|---|
| PubChem CID | 164904271 |
| Molecular Formula | C12H9BrCl3FN2O4 |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 447.88 |
| IUPAC Name | methyl 4-bromo-3-fluoro-5-methyl-2-[(2,2,2-trichloroacetyl)carbamoylamino]benzoate |
| SMILES | COC(=O)c1cc(C)c(Br)c(F)c1NC(=O)NC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H9BrCl3FN2O4/c1-4-3-5(9(20)23-2)8(7(17)6(4)13)18-11(22)19-10(21)12(14,15)16/h3H,1-2H3,(H2,18,19,21,22) |
| InChIKey | KCAYYLXCMIMQJJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|