C25H32BrFIN5O3 — CID 164904443
tert-butyl 4-[7-bromo-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6-iodoquinazolin-4-yl]piperazine-1-carboxylate (PubChem CID 164904443) has the molecular formula C25H32BrFIN5O3 and a molecular weight of 676.37 g/mol. Its IUPAC name is tert-butyl 4-[7-bromo-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6-iodoquinazolin-4-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[7-bromo-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6-iodoquinazolin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 164904443 |
| Molecular Formula | C25H32BrFIN5O3 |
| Molecular Weight | 676.37 g/mol |
| Exact Mass | 675.07 |
| IUPAC Name | tert-butyl 4-[7-bromo-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6-iodoquinazolin-4-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2nc(OCC34CCCN3CCC4)nc3c(F)c(Br)c(I)cc23)CC1 |
| InChI | InChI=1S/C25H32BrFIN5O3/c1-24(2,3)36-23(34)32-12-10-31(11-13-32)21-16-14-17(28)18(26)19(27)20(16)29-22(30-21)35-15-25-6-4-8-33(25)9-5-7-25/h14H,4-13,15H2,1-3H3 |
| InChIKey | IMGVTZPNRHTISB-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 71.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.37 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|