C9H16N4O — CID 164904599
2-[1-(2-aminoacetyl)-4-methylpiperazin-2-yl]acetonitrile (PubChem CID 164904599) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-[1-(2-aminoacetyl)-4-methylpiperazin-2-yl]acetonitrile.
| Compound Name | 2-[1-(2-aminoacetyl)-4-methylpiperazin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 164904599 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 2-[1-(2-aminoacetyl)-4-methylpiperazin-2-yl]acetonitrile |
| SMILES | CN1CCN(C(=O)CN)C(CC#N)C1 |
| InChI | InChI=1S/C9H16N4O/c1-12-4-5-13(9(14)6-11)8(7-12)2-3-10/h8H,2,4-7,11H2,1H3 |
| InChIKey | CMRZHZXWDYFMQD-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 73.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |