C32H56S — CID 164904926
10,13-dimethyl-17-(6-methylheptan-2-yl)-3-pentan-3-ylsulfanyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 164904926) has the molecular formula C32H56S and a molecular weight of 472.87 g/mol. Its IUPAC name is 10,13-dimethyl-17-(6-methylheptan-2-yl)-3-pentan-3-ylsulfanyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | 10,13-dimethyl-17-(6-methylheptan-2-yl)-3-pentan-3-ylsulfanyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 164904926 |
| Molecular Formula | C32H56S |
| Molecular Weight | 472.87 g/mol |
| Exact Mass | 472.41 |
| IUPAC Name | 10,13-dimethyl-17-(6-methylheptan-2-yl)-3-pentan-3-ylsulfanyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CCC(CC)SC1CCC2(C)C(=CCC3C2CCC2(C)C(C(C)CCCC(C)C)CCC32)C1 |
| InChI | InChI=1S/C32H56S/c1-8-25(9-2)33-26-17-19-31(6)24(21-26)13-14-27-29-16-15-28(23(5)12-10-11-22(3)4)32(29,7)20-18-30(27)31/h13,22-23,25-30H,8-12,14-21H2,1-7H3 |
| InChIKey | VXIJVCPKSLTECG-UHFFFAOYSA-N |
| XLogP | 10.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.87 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|