About tert-butyl 2-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]acetate
tert-butyl 2-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]acetate (PubChem CID 164905846) has the molecular formula C9H12F3N3O2
and a molecular weight of 251.21 g/mol. Its IUPAC name is tert-butyl 2-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]acetate |
| PubChem CID | 164905846 |
| Molecular Formula | C9H12F3N3O2 |
| Molecular Weight | 251.21 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | tert-butyl 2-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)Cn1cnc(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H12F3N3O2/c1-8(2,3)17-6(16)4-15-5-13-7(14-15)9(10,11)12/h5H,4H2,1-3H3 |
| InChIKey | JKQFRLHDCYETKW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.21 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 2-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]acetate?
The IUPAC name of tert-butyl 2-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]acetate (CID 164905846) is tert-butyl 2-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]acetate.
What is the SMILES notation for tert-butyl 2-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]acetate?
The canonical SMILES for tert-butyl 2-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]acetate is CC(C)(C)OC(=O)Cn1cnc(C(F)(F)F)n1.
What is the InChIKey of tert-butyl 2-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]acetate?
The InChIKey is JKQFRLHDCYETKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F3N3O2/c1-8(2,3)17-6(16)4-15-5-13-7(14-15)9(10,11)12/h5H,4H2,1-3H3.
What are the key properties of tert-butyl 2-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]acetate?
tert-butyl 2-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]acetate has a molecular weight of 251.21 g/mol, XLogP of 1.64, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]acetate is sourced from PubChem (CID 164905846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).