C16H23F3N2 — CID 164906062
(3S)-N,1-dimethyl-N-[(1E,3Z,7Z)-7-methyl-8-(trifluoromethyl)cycloocta-1,3,7-trien-1-yl]pyrrolidin-3-amine (PubChem CID 164906062) has the molecular formula C16H23F3N2 and a molecular weight of 300.37 g/mol. Its IUPAC name is (3S)-N,1-dimethyl-N-[(1E,3Z,7Z)-7-methyl-8-(trifluoromethyl)cycloocta-1,3,7-trien-1-yl]pyrrolidin-3-amine.
| Compound Name | (3S)-N,1-dimethyl-N-[(1E,3Z,7Z)-7-methyl-8-(trifluoromethyl)cycloocta-1,3,7-trien-1-yl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 164906062 |
| Molecular Formula | C16H23F3N2 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | (3S)-N,1-dimethyl-N-[(1E,3Z,7Z)-7-methyl-8-(trifluoromethyl)cycloocta-1,3,7-trien-1-yl]pyrrolidin-3-amine |
| SMILES | C/C1=C(C(F)(F)F)/C(N(C)[C@H]2CCN(C)C2)=C\C=C/CC1 |
| InChI | InChI=1S/C16H23F3N2/c1-12-7-5-4-6-8-14(15(12)16(17,18)19)21(3)13-9-10-20(2)11-13/h4,6,8,13H,5,7,9-11H2,1-3H3/b6-4-,14-8+,15-12+/t13-/m0/s1 |
| InChIKey | XEIIMIYDJXBVCN-YYXFBRSTSA-N |
| XLogP | 3.73 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |