About CID 164906500
CID 164906500 (PubChem CID 164906500) has the molecular formula C8H5BClN
and a molecular weight of 161.40 g/mol.
Molecular Properties
| Compound Name | CID 164906500 |
| PubChem CID | 164906500 |
| Molecular Formula | C8H5BClN |
| Molecular Weight | 161.40 g/mol |
| Exact Mass | 161.02 |
| IUPAC Name | — |
| SMILES | [B]c1cc(Cl)cc(C#N)c1C |
| InChI | InChI=1S/C8H5BClN/c1-5-6(4-11)2-7(10)3-8(5)9/h2-3H,1H3 |
| InChIKey | OKYOFTQCQYDZBG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.40 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 164906500 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164906500?
The IUPAC name of CID 164906500 (CID 164906500) is not available.
What is the SMILES notation for CID 164906500?
The canonical SMILES for CID 164906500 is [B]c1cc(Cl)cc(C#N)c1C.
What is the InChIKey of CID 164906500?
The InChIKey is OKYOFTQCQYDZBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BClN/c1-5-6(4-11)2-7(10)3-8(5)9/h2-3H,1H3.
What are the key properties of CID 164906500?
CID 164906500 has a molecular weight of 161.40 g/mol, XLogP of 1.31, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164906500 is sourced from PubChem (CID 164906500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).