C44H23F12NO5 — CID 164906663
4-[4-[10,18-bis[3,5-bis(trifluoromethyl)phenyl]-13,15-dioxo-8-oxa-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(18),2,4,6,9,11,16,19-octaen-14-yl]phenyl]butanoic acid (PubChem CID 164906663) has the molecular formula C44H23F12NO5 and a molecular weight of 873.65 g/mol. Its IUPAC name is 4-[4-[10,18-bis[3,5-bis(trifluoromethyl)phenyl]-13,15-dioxo-8-oxa-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(18),2,4,6,9,11,16,19-octaen-14-yl]phenyl]butanoic acid.
| Compound Name | 4-[4-[10,18-bis[3,5-bis(trifluoromethyl)phenyl]-13,15-dioxo-8-oxa-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(18),2,4,6,9,11,16,19-octaen-14-yl]phenyl]butanoic acid |
|---|---|
| PubChem CID | 164906663 |
| Molecular Formula | C44H23F12NO5 |
| Molecular Weight | 873.65 g/mol |
| Exact Mass | 873.14 |
| IUPAC Name | 4-[4-[10,18-bis[3,5-bis(trifluoromethyl)phenyl]-13,15-dioxo-8-oxa-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(18),2,4,6,9,11,16,19-octaen-14-yl]phenyl]butanoic acid |
| SMILES | O=C(O)CCCc1ccc(-n2c(=O)c3cc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)c4oc5ccccc5c5c(-c6cc(C(F)(F)F)cc(C(F)(F)F)c6)cc(c2=O)c3c45)cc1 |
| InChI | InChI=1S/C44H23F12NO5/c45-41(46,47)23-12-21(13-24(16-23)42(48,49)50)29-18-31-36-32(40(61)57(39(31)60)27-10-8-20(9-11-27)4-3-7-34(58)59)19-30(38-37(36)35(29)28-5-1-2-6-33(28)62-38)22-14-25(43(51,52)53)17-26(15-22)44(54,55)56/h1-2,5-6,8-19H,3-4,7H2,(H,58,59) |
| InChIKey | GXDSOSGBBWEOJU-UHFFFAOYSA-N |
| XLogP | 12.66 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.65 |
| LogP ≤ 5 | 12.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|