C27H16F3NO4 — CID 164906859
14-(2-hydroxyethyl)-4-[4-(trifluoromethyl)phenyl]-8-oxa-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2(7),3,5,9,11,16(20),17-octaene-13,15-dione (PubChem CID 164906859) has the molecular formula C27H16F3NO4 and a molecular weight of 475.42 g/mol. Its IUPAC name is 14-(2-hydroxyethyl)-4-[4-(trifluoromethyl)phenyl]-8-oxa-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2(7),3,5,9,11,16(20),17-octaene-13,15-dione.
| Compound Name | 14-(2-hydroxyethyl)-4-[4-(trifluoromethyl)phenyl]-8-oxa-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2(7),3,5,9,11,16(20),17-octaene-13,15-dione |
|---|---|
| PubChem CID | 164906859 |
| Molecular Formula | C27H16F3NO4 |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 14-(2-hydroxyethyl)-4-[4-(trifluoromethyl)phenyl]-8-oxa-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2(7),3,5,9,11,16(20),17-octaene-13,15-dione |
| SMILES | O=c1c2ccc3oc4ccc(-c5ccc(C(F)(F)F)cc5)cc4c4ccc(c(=O)n1CCO)c2c34 |
| InChI | InChI=1S/C27H16F3NO4/c28-27(29,30)16-4-1-14(2-5-16)15-3-9-21-20(13-15)17-6-7-18-23-19(8-10-22(35-21)24(17)23)26(34)31(11-12-32)25(18)33/h1-10,13,32H,11-12H2 |
| InChIKey | RSRLQPXVFUNBGN-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|