About formaldehyde;methoxymethane;1-(3-methylpyrrolidin-1-yl)propan-1-one
formaldehyde;methoxymethane;1-(3-methylpyrrolidin-1-yl)propan-1-one (PubChem CID 164907006) has the molecular formula C11H23NO3
and a molecular weight of 217.31 g/mol. Its IUPAC name is formaldehyde;methoxymethane;1-(3-methylpyrrolidin-1-yl)propan-1-one.
Molecular Properties
| Compound Name | formaldehyde;methoxymethane;1-(3-methylpyrrolidin-1-yl)propan-1-one |
| PubChem CID | 164907006 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | formaldehyde;methoxymethane;1-(3-methylpyrrolidin-1-yl)propan-1-one |
| SMILES | C=O.CCC(=O)N1CCC(C)C1.COC |
| InChI | InChI=1S/C8H15NO.C2H6O.CH2O/c1-3-8(10)9-5-4-7(2)6-9;1-3-2;1-2/h7H,3-6H2,1-2H3;1-2H3;1H2 |
| InChIKey | VTJRMNMAEVEXBK-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze formaldehyde;methoxymethane;1-(3-methylpyrrolidin-1-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;methoxymethane;1-(3-methylpyrrolidin-1-yl)propan-1-one?
The IUPAC name of formaldehyde;methoxymethane;1-(3-methylpyrrolidin-1-yl)propan-1-one (CID 164907006) is formaldehyde;methoxymethane;1-(3-methylpyrrolidin-1-yl)propan-1-one.
What is the SMILES notation for formaldehyde;methoxymethane;1-(3-methylpyrrolidin-1-yl)propan-1-one?
The canonical SMILES for formaldehyde;methoxymethane;1-(3-methylpyrrolidin-1-yl)propan-1-one is C=O.CCC(=O)N1CCC(C)C1.COC.
What is the InChIKey of formaldehyde;methoxymethane;1-(3-methylpyrrolidin-1-yl)propan-1-one?
The InChIKey is VTJRMNMAEVEXBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO.C2H6O.CH2O/c1-3-8(10)9-5-4-7(2)6-9;1-3-2;1-2/h7H,3-6H2,1-2H3;1-2H3;1H2.
What are the key properties of formaldehyde;methoxymethane;1-(3-methylpyrrolidin-1-yl)propan-1-one?
formaldehyde;methoxymethane;1-(3-methylpyrrolidin-1-yl)propan-1-one has a molecular weight of 217.31 g/mol, XLogP of 1.34, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;methoxymethane;1-(3-methylpyrrolidin-1-yl)propan-1-one is sourced from PubChem (CID 164907006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).