C23H41N3 — CID 164907349
2,5,5-trimethyl-N-[7-(5-methyl-2-methylideneimidazolidin-4-yl)hept-1-en-2-yl]oct-7-yn-2-amine (PubChem CID 164907349) has the molecular formula C23H41N3 and a molecular weight of 359.60 g/mol. Its IUPAC name is 2,5,5-trimethyl-N-[7-(5-methyl-2-methylideneimidazolidin-4-yl)hept-1-en-2-yl]oct-7-yn-2-amine.
| Compound Name | 2,5,5-trimethyl-N-[7-(5-methyl-2-methylideneimidazolidin-4-yl)hept-1-en-2-yl]oct-7-yn-2-amine |
|---|---|
| PubChem CID | 164907349 |
| Molecular Formula | C23H41N3 |
| Molecular Weight | 359.60 g/mol |
| Exact Mass | 359.33 |
| IUPAC Name | 2,5,5-trimethyl-N-[7-(5-methyl-2-methylideneimidazolidin-4-yl)hept-1-en-2-yl]oct-7-yn-2-amine |
| SMILES | C#CCC(C)(C)CCC(C)(C)NC(=C)CCCCCC1NC(=C)NC1C |
| InChI | InChI=1S/C23H41N3/c1-9-15-22(5,6)16-17-23(7,8)26-18(2)13-11-10-12-14-21-19(3)24-20(4)25-21/h1,19,21,24-26H,2,4,10-17H2,3,5-8H3 |
| InChIKey | ZYBAKMMCCWURNZ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.60 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|