About 5-(2,2-difluoroethyl)-4-methoxypyrimidin-2-amine
5-(2,2-difluoroethyl)-4-methoxypyrimidin-2-amine (PubChem CID 164907938) has the molecular formula C7H9F2N3O
and a molecular weight of 189.17 g/mol. Its IUPAC name is 5-(2,2-difluoroethyl)-4-methoxypyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-(2,2-difluoroethyl)-4-methoxypyrimidin-2-amine |
| PubChem CID | 164907938 |
| Molecular Formula | C7H9F2N3O |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | 5-(2,2-difluoroethyl)-4-methoxypyrimidin-2-amine |
| SMILES | COc1nc(N)ncc1CC(F)F |
| InChI | InChI=1S/C7H9F2N3O/c1-13-6-4(2-5(8)9)3-11-7(10)12-6/h3,5H,2H2,1H3,(H2,10,11,12) |
| InChIKey | NHSAFNJUAJBHDJ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2,2-difluoroethyl)-4-methoxypyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-difluoroethyl)-4-methoxypyrimidin-2-amine?
The IUPAC name of 5-(2,2-difluoroethyl)-4-methoxypyrimidin-2-amine (CID 164907938) is 5-(2,2-difluoroethyl)-4-methoxypyrimidin-2-amine.
What is the SMILES notation for 5-(2,2-difluoroethyl)-4-methoxypyrimidin-2-amine?
The canonical SMILES for 5-(2,2-difluoroethyl)-4-methoxypyrimidin-2-amine is COc1nc(N)ncc1CC(F)F.
What is the InChIKey of 5-(2,2-difluoroethyl)-4-methoxypyrimidin-2-amine?
The InChIKey is NHSAFNJUAJBHDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F2N3O/c1-13-6-4(2-5(8)9)3-11-7(10)12-6/h3,5H,2H2,1H3,(H2,10,11,12).
What are the key properties of 5-(2,2-difluoroethyl)-4-methoxypyrimidin-2-amine?
5-(2,2-difluoroethyl)-4-methoxypyrimidin-2-amine has a molecular weight of 189.17 g/mol, XLogP of 0.88, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-difluoroethyl)-4-methoxypyrimidin-2-amine is sourced from PubChem (CID 164907938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).