C14H11ClF3N5O4S — CID 164908021
6-chloro-N-[4-methoxy-5-(1,1,2-trifluoroethoxy)pyrimidin-2-yl]-1H-pyrrolo[2,3-b]pyridine-3-sulfonamide (PubChem CID 164908021) has the molecular formula C14H11ClF3N5O4S and a molecular weight of 437.79 g/mol. Its IUPAC name is 6-chloro-N-[4-methoxy-5-(1,1,2-trifluoroethoxy)pyrimidin-2-yl]-1H-pyrrolo[2,3-b]pyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-[4-methoxy-5-(1,1,2-trifluoroethoxy)pyrimidin-2-yl]-1H-pyrrolo[2,3-b]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 164908021 |
| Molecular Formula | C14H11ClF3N5O4S |
| Molecular Weight | 437.79 g/mol |
| Exact Mass | 437.02 |
| IUPAC Name | 6-chloro-N-[4-methoxy-5-(1,1,2-trifluoroethoxy)pyrimidin-2-yl]-1H-pyrrolo[2,3-b]pyridine-3-sulfonamide |
| SMILES | COc1nc(NS(=O)(=O)c2c[nH]c3nc(Cl)ccc23)ncc1OC(F)(F)CF |
| InChI | InChI=1S/C14H11ClF3N5O4S/c1-26-12-8(27-14(17,18)6-16)4-20-13(22-12)23-28(24,25)9-5-19-11-7(9)2-3-10(15)21-11/h2-5H,6H2,1H3,(H,19,21)(H,20,22,23) |
| InChIKey | BKQSPQAPXFWWQU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 119.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.79 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|