C14H12ClF2N5O5S — CID 164908120
6-chloro-N-[5-(difluoromethoxy)-4,6-dimethoxypyrimidin-2-yl]-1H-pyrrolo[2,3-b]pyridine-3-sulfonamide (PubChem CID 164908120) has the molecular formula C14H12ClF2N5O5S and a molecular weight of 435.80 g/mol. Its IUPAC name is 6-chloro-N-[5-(difluoromethoxy)-4,6-dimethoxypyrimidin-2-yl]-1H-pyrrolo[2,3-b]pyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-[5-(difluoromethoxy)-4,6-dimethoxypyrimidin-2-yl]-1H-pyrrolo[2,3-b]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 164908120 |
| Molecular Formula | C14H12ClF2N5O5S |
| Molecular Weight | 435.80 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | 6-chloro-N-[5-(difluoromethoxy)-4,6-dimethoxypyrimidin-2-yl]-1H-pyrrolo[2,3-b]pyridine-3-sulfonamide |
| SMILES | COc1nc(NS(=O)(=O)c2c[nH]c3nc(Cl)ccc23)nc(OC)c1OC(F)F |
| InChI | InChI=1S/C14H12ClF2N5O5S/c1-25-11-9(27-13(16)17)12(26-2)21-14(20-11)22-28(23,24)7-5-18-10-6(7)3-4-8(15)19-10/h3-5,13H,1-2H3,(H,18,19)(H,20,21,22) |
| InChIKey | CIJXWPOFRWZWOQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 128.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.80 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|