C18H25N5O2 — CID 164908600
(2-aminophenyl) cyclohexanecarboxylate;pyridine-2,3,6-triamine (PubChem CID 164908600) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is (2-aminophenyl) cyclohexanecarboxylate;pyridine-2,3,6-triamine.
| Compound Name | (2-aminophenyl) cyclohexanecarboxylate;pyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 164908600 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | (2-aminophenyl) cyclohexanecarboxylate;pyridine-2,3,6-triamine |
| SMILES | Nc1ccc(N)c(N)n1.Nc1ccccc1OC(=O)C1CCCCC1 |
| InChI | InChI=1S/C13H17NO2.C5H8N4/c14-11-8-4-5-9-12(11)16-13(15)10-6-2-1-3-7-10;6-3-1-2-4(7)9-5(3)8/h4-5,8-10H,1-3,6-7,14H2;1-2H,6H2,(H4,7,8,9) |
| InChIKey | SKMBUKVMOHSGEI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 143.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|