C21H31N7O3 — CID 164908920
(2-aminophenyl) 4-morpholin-4-ylpiperidine-1-carboxylate;pyridine-2,3,6-triamine (PubChem CID 164908920) has the molecular formula C21H31N7O3 and a molecular weight of 429.53 g/mol. Its IUPAC name is (2-aminophenyl) 4-morpholin-4-ylpiperidine-1-carboxylate;pyridine-2,3,6-triamine.
| Compound Name | (2-aminophenyl) 4-morpholin-4-ylpiperidine-1-carboxylate;pyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 164908920 |
| Molecular Formula | C21H31N7O3 |
| Molecular Weight | 429.53 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | (2-aminophenyl) 4-morpholin-4-ylpiperidine-1-carboxylate;pyridine-2,3,6-triamine |
| SMILES | Nc1ccc(N)c(N)n1.Nc1ccccc1OC(=O)N1CCC(N2CCOCC2)CC1 |
| InChI | InChI=1S/C16H23N3O3.C5H8N4/c17-14-3-1-2-4-15(14)22-16(20)19-7-5-13(6-8-19)18-9-11-21-12-10-18;6-3-1-2-4(7)9-5(3)8/h1-4,13H,5-12,17H2;1-2H,6H2,(H4,7,8,9) |
| InChIKey | YTRMNGCUFUZHHP-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 158.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.53 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|