C22H35N7O2 — CID 164909242
(2-aminophenyl) 4-[ethyl(propyl)amino]piperidine-1-carboxylate;pyridine-2,3,6-triamine (PubChem CID 164909242) has the molecular formula C22H35N7O2 and a molecular weight of 429.57 g/mol. Its IUPAC name is (2-aminophenyl) 4-[ethyl(propyl)amino]piperidine-1-carboxylate;pyridine-2,3,6-triamine.
| Compound Name | (2-aminophenyl) 4-[ethyl(propyl)amino]piperidine-1-carboxylate;pyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 164909242 |
| Molecular Formula | C22H35N7O2 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.29 |
| IUPAC Name | (2-aminophenyl) 4-[ethyl(propyl)amino]piperidine-1-carboxylate;pyridine-2,3,6-triamine |
| SMILES | CCCN(CC)C1CCN(C(=O)Oc2ccccc2N)CC1.Nc1ccc(N)c(N)n1 |
| InChI | InChI=1S/C17H27N3O2.C5H8N4/c1-3-11-19(4-2)14-9-12-20(13-10-14)17(21)22-16-8-6-5-7-15(16)18;6-3-1-2-4(7)9-5(3)8/h5-8,14H,3-4,9-13,18H2,1-2H3;1-2H,6H2,(H4,7,8,9) |
| InChIKey | QESLDIXCQCIHLL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 149.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|