About 3-tert-butyl-2-[(2,6-diamino-3-pyridinyl)diazenyl]phenol;hydrochloride
3-tert-butyl-2-[(2,6-diamino-3-pyridinyl)diazenyl]phenol;hydrochloride (PubChem CID 164909334) has the molecular formula C15H20ClN5O
and a molecular weight of 321.81 g/mol. Its IUPAC name is 3-tert-butyl-2-[(2,6-diamino-3-pyridinyl)diazenyl]phenol;hydrochloride.
Molecular Properties
| Compound Name | 3-tert-butyl-2-[(2,6-diamino-3-pyridinyl)diazenyl]phenol;hydrochloride |
| PubChem CID | 164909334 |
| Molecular Formula | C15H20ClN5O |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 3-tert-butyl-2-[(2,6-diamino-3-pyridinyl)diazenyl]phenol;hydrochloride |
| SMILES | CC(C)(C)c1cccc(O)c1/N=N/c1ccc(N)nc1N.Cl |
| InChI | InChI=1S/C15H19N5O.ClH/c1-15(2,3)9-5-4-6-11(21)13(9)20-19-10-7-8-12(16)18-14(10)17;/h4-8,21H,1-3H3,(H4,16,17,18);1H/b20-19+; |
| InChIKey | SJEOMICUECJUGI-RZLHGTIFSA-N |
| XLogP | 4.09 |
| TPSA | 109.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butyl-2-[(2,6-diamino-3-pyridinyl)diazenyl]phenol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-2-[(2,6-diamino-3-pyridinyl)diazenyl]phenol;hydrochloride?
The IUPAC name of 3-tert-butyl-2-[(2,6-diamino-3-pyridinyl)diazenyl]phenol;hydrochloride (CID 164909334) is 3-tert-butyl-2-[(2,6-diamino-3-pyridinyl)diazenyl]phenol;hydrochloride.
What is the SMILES notation for 3-tert-butyl-2-[(2,6-diamino-3-pyridinyl)diazenyl]phenol;hydrochloride?
The canonical SMILES for 3-tert-butyl-2-[(2,6-diamino-3-pyridinyl)diazenyl]phenol;hydrochloride is CC(C)(C)c1cccc(O)c1/N=N/c1ccc(N)nc1N.Cl.
What is the InChIKey of 3-tert-butyl-2-[(2,6-diamino-3-pyridinyl)diazenyl]phenol;hydrochloride?
The InChIKey is SJEOMICUECJUGI-RZLHGTIFSA-N. The full InChI is InChI=1S/C15H19N5O.ClH/c1-15(2,3)9-5-4-6-11(21)13(9)20-19-10-7-8-12(16)18-14(10)17;/h4-8,21H,1-3H3,(H4,16,17,18);1H/b20-19+;.
What are the key properties of 3-tert-butyl-2-[(2,6-diamino-3-pyridinyl)diazenyl]phenol;hydrochloride?
3-tert-butyl-2-[(2,6-diamino-3-pyridinyl)diazenyl]phenol;hydrochloride has a molecular weight of 321.81 g/mol, XLogP of 4.09, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-2-[(2,6-diamino-3-pyridinyl)diazenyl]phenol;hydrochloride is sourced from PubChem (CID 164909334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).