About cyano(trimethyl)azanium tetrafluoroborate
cyano(trimethyl)azanium tetrafluoroborate (PubChem CID 164909464) has the molecular formula C4H9BF4N2
and a molecular weight of 171.93 g/mol. Its IUPAC name is cyano(trimethyl)azanium tetrafluoroborate.
Molecular Properties
| Compound Name | cyano(trimethyl)azanium tetrafluoroborate |
| PubChem CID | 164909464 |
| Molecular Formula | C4H9BF4N2 |
| Molecular Weight | 171.93 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | cyano(trimethyl)azanium tetrafluoroborate |
| SMILES | C[N+](C)(C)C#N.F[B-](F)(F)F |
| InChI | InChI=1S/C4H9N2.BF4/c1-6(2,3)4-5;2-1(3,4)5/h1-3H3;/q+1;-1 |
| InChIKey | WFAQRYWYKNUION-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.93 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze cyano(trimethyl)azanium tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyano(trimethyl)azanium tetrafluoroborate?
The IUPAC name of cyano(trimethyl)azanium tetrafluoroborate (CID 164909464) is cyano(trimethyl)azanium tetrafluoroborate.
What is the SMILES notation for cyano(trimethyl)azanium tetrafluoroborate?
The canonical SMILES for cyano(trimethyl)azanium tetrafluoroborate is C[N+](C)(C)C#N.F[B-](F)(F)F.
What is the InChIKey of cyano(trimethyl)azanium tetrafluoroborate?
The InChIKey is WFAQRYWYKNUION-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N2.BF4/c1-6(2,3)4-5;2-1(3,4)5/h1-3H3;/q+1;-1.
What are the key properties of cyano(trimethyl)azanium tetrafluoroborate?
cyano(trimethyl)azanium tetrafluoroborate has a molecular weight of 171.93 g/mol, XLogP of 1.47, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyano(trimethyl)azanium tetrafluoroborate is sourced from PubChem (CID 164909464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).