C32H32F8N4O4 — CID 164910453
8-(2,2-difluoroethoxy)-3,6-dimethylquinoline;N-[2-[5-(2,2-difluoroethoxy)-6-(4-fluorophenyl)-4-methyl-2-pyridinyl]-3,3,3-trifluoropropyl]formamide;formamide (PubChem CID 164910453) has the molecular formula C32H32F8N4O4 and a molecular weight of 688.62 g/mol. Its IUPAC name is 8-(2,2-difluoroethoxy)-3,6-dimethylquinoline;N-[2-[5-(2,2-difluoroethoxy)-6-(4-fluorophenyl)-4-methyl-2-pyridinyl]-3,3,3-trifluoropropyl]formamide;formamide.
| Compound Name | 8-(2,2-difluoroethoxy)-3,6-dimethylquinoline;N-[2-[5-(2,2-difluoroethoxy)-6-(4-fluorophenyl)-4-methyl-2-pyridinyl]-3,3,3-trifluoropropyl]formamide;formamide |
|---|---|
| PubChem CID | 164910453 |
| Molecular Formula | C32H32F8N4O4 |
| Molecular Weight | 688.62 g/mol |
| Exact Mass | 688.23 |
| IUPAC Name | 8-(2,2-difluoroethoxy)-3,6-dimethylquinoline;N-[2-[5-(2,2-difluoroethoxy)-6-(4-fluorophenyl)-4-methyl-2-pyridinyl]-3,3,3-trifluoropropyl]formamide;formamide |
| SMILES | Cc1cc(C(CNC=O)C(F)(F)F)nc(-c2ccc(F)cc2)c1OCC(F)F.Cc1cnc2c(OCC(F)F)cc(C)cc2c1.NC=O |
| InChI | InChI=1S/C18H16F6N2O2.C13H13F2NO.CH3NO/c1-10-6-14(13(7-25-9-27)18(22,23)24)26-16(17(10)28-8-15(20)21)11-2-4-12(19)5-3-11;1-8-3-10-4-9(2)6-16-13(10)11(5-8)17-7-12(14)15;2-1-3/h2-6,9,13,15H,7-8H2,1H3,(H,25,27);3-6,12H,7H2,1-2H3;1H,(H2,2,3) |
| InChIKey | AJYZZMZTWUUYLM-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 116.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.62 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|