About 6-(hydroxymethyl)-[1,3]dioxolo[4,5-c]pyridine-2-thione;palladium
6-(hydroxymethyl)-[1,3]dioxolo[4,5-c]pyridine-2-thione;palladium (PubChem CID 164910534) has the molecular formula C7H5NO3PdS
and a molecular weight of 289.61 g/mol. Its IUPAC name is 6-(hydroxymethyl)-[1,3]dioxolo[4,5-c]pyridine-2-thione;palladium.
Molecular Properties
| Compound Name | 6-(hydroxymethyl)-[1,3]dioxolo[4,5-c]pyridine-2-thione;palladium |
| PubChem CID | 164910534 |
| Molecular Formula | C7H5NO3PdS |
| Molecular Weight | 289.61 g/mol |
| Exact Mass | 288.90 |
| IUPAC Name | 6-(hydroxymethyl)-[1,3]dioxolo[4,5-c]pyridine-2-thione;palladium |
| SMILES | OCc1cc2oc(=S)oc2cn1.[Pd] |
| InChI | InChI=1S/C7H5NO3S.Pd/c9-3-4-1-5-6(2-8-4)11-7(12)10-5;/h1-2,9H,3H2; |
| InChIKey | JWANJVZKMKODEA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.61 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-(hydroxymethyl)-[1,3]dioxolo[4,5-c]pyridine-2-thione;palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(hydroxymethyl)-[1,3]dioxolo[4,5-c]pyridine-2-thione;palladium?
The IUPAC name of 6-(hydroxymethyl)-[1,3]dioxolo[4,5-c]pyridine-2-thione;palladium (CID 164910534) is 6-(hydroxymethyl)-[1,3]dioxolo[4,5-c]pyridine-2-thione;palladium.
What is the SMILES notation for 6-(hydroxymethyl)-[1,3]dioxolo[4,5-c]pyridine-2-thione;palladium?
The canonical SMILES for 6-(hydroxymethyl)-[1,3]dioxolo[4,5-c]pyridine-2-thione;palladium is OCc1cc2oc(=S)oc2cn1.[Pd].
What is the InChIKey of 6-(hydroxymethyl)-[1,3]dioxolo[4,5-c]pyridine-2-thione;palladium?
The InChIKey is JWANJVZKMKODEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO3S.Pd/c9-3-4-1-5-6(2-8-4)11-7(12)10-5;/h1-2,9H,3H2;.
What are the key properties of 6-(hydroxymethyl)-[1,3]dioxolo[4,5-c]pyridine-2-thione;palladium?
6-(hydroxymethyl)-[1,3]dioxolo[4,5-c]pyridine-2-thione;palladium has a molecular weight of 289.61 g/mol, XLogP of 1.64, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(hydroxymethyl)-[1,3]dioxolo[4,5-c]pyridine-2-thione;palladium is sourced from PubChem (CID 164910534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).