C31H35F3N4O4 — CID 164910561
4-amino-3-(cyclopropyliminomethyl)-N-[4-hydroxy-2-[5-methoxy-4-propan-2-yl-6-(3,4,5-trifluorophenyl)-2-pyridinyl]butyl]-5-methoxybenzamide (PubChem CID 164910561) has the molecular formula C31H35F3N4O4 and a molecular weight of 584.64 g/mol. Its IUPAC name is 4-amino-3-(cyclopropyliminomethyl)-N-[4-hydroxy-2-[5-methoxy-4-propan-2-yl-6-(3,4,5-trifluorophenyl)-2-pyridinyl]butyl]-5-methoxybenzamide.
| Compound Name | 4-amino-3-(cyclopropyliminomethyl)-N-[4-hydroxy-2-[5-methoxy-4-propan-2-yl-6-(3,4,5-trifluorophenyl)-2-pyridinyl]butyl]-5-methoxybenzamide |
|---|---|
| PubChem CID | 164910561 |
| Molecular Formula | C31H35F3N4O4 |
| Molecular Weight | 584.64 g/mol |
| Exact Mass | 584.26 |
| IUPAC Name | 4-amino-3-(cyclopropyliminomethyl)-N-[4-hydroxy-2-[5-methoxy-4-propan-2-yl-6-(3,4,5-trifluorophenyl)-2-pyridinyl]butyl]-5-methoxybenzamide |
| SMILES | COc1cc(C(=O)NCC(CCO)c2cc(C(C)C)c(OC)c(-c3cc(F)c(F)c(F)c3)n2)cc(/C=N/C2CC2)c1N |
| InChI | InChI=1S/C31H35F3N4O4/c1-16(2)22-13-25(38-29(30(22)42-4)18-10-23(32)27(34)24(33)11-18)17(7-8-39)14-37-31(40)19-9-20(15-36-21-5-6-21)28(35)26(12-19)41-3/h9-13,15-17,21,39H,5-8,14,35H2,1-4H3,(H,37,40)/b36-15+ |
| InChIKey | JXSWCONSECPXDV-IRWBXMRWSA-N |
| XLogP | 5.37 |
| TPSA | 119.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.64 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|