C30H35N3O2 — CID 164910973
2-(cyclopropyliminomethyl)-6-methoxy-4-[2-[3-methyl-7-(3-propylphenyl)-2,3-dihydrofuro[2,3-c]pyridin-5-yl]ethyl]aniline (PubChem CID 164910973) has the molecular formula C30H35N3O2 and a molecular weight of 469.63 g/mol. Its IUPAC name is 2-(cyclopropyliminomethyl)-6-methoxy-4-[2-[3-methyl-7-(3-propylphenyl)-2,3-dihydrofuro[2,3-c]pyridin-5-yl]ethyl]aniline.
| Compound Name | 2-(cyclopropyliminomethyl)-6-methoxy-4-[2-[3-methyl-7-(3-propylphenyl)-2,3-dihydrofuro[2,3-c]pyridin-5-yl]ethyl]aniline |
|---|---|
| PubChem CID | 164910973 |
| Molecular Formula | C30H35N3O2 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | 2-(cyclopropyliminomethyl)-6-methoxy-4-[2-[3-methyl-7-(3-propylphenyl)-2,3-dihydrofuro[2,3-c]pyridin-5-yl]ethyl]aniline |
| SMILES | CCCc1cccc(-c2nc(CCc3cc(/C=N/C4CC4)c(N)c(OC)c3)cc3c2OCC3C)c1 |
| InChI | InChI=1S/C30H35N3O2/c1-4-6-20-7-5-8-22(13-20)29-30-26(19(2)18-35-30)16-25(33-29)10-9-21-14-23(17-32-24-11-12-24)28(31)27(15-21)34-3/h5,7-8,13-17,19,24H,4,6,9-12,18,31H2,1-3H3/b32-17+ |
| InChIKey | DMXNUBACGOWQMN-VTNSRFBWSA-N |
| XLogP | 6.15 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|