C29H34ClFN6O3 — CID 164911533
4-amino-N-[2-[6-(2-chloro-3-fluoro-4-pyridinyl)-4-(ethylamino)-5-hydroxy-2-pyridinyl]-2-cyclopropylethyl]-3-methoxy-5-(propyliminomethyl)benzamide (PubChem CID 164911533) has the molecular formula C29H34ClFN6O3 and a molecular weight of 569.08 g/mol. Its IUPAC name is 4-amino-N-[2-[6-(2-chloro-3-fluoro-4-pyridinyl)-4-(ethylamino)-5-hydroxy-2-pyridinyl]-2-cyclopropylethyl]-3-methoxy-5-(propyliminomethyl)benzamide.
| Compound Name | 4-amino-N-[2-[6-(2-chloro-3-fluoro-4-pyridinyl)-4-(ethylamino)-5-hydroxy-2-pyridinyl]-2-cyclopropylethyl]-3-methoxy-5-(propyliminomethyl)benzamide |
|---|---|
| PubChem CID | 164911533 |
| Molecular Formula | C29H34ClFN6O3 |
| Molecular Weight | 569.08 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | 4-amino-N-[2-[6-(2-chloro-3-fluoro-4-pyridinyl)-4-(ethylamino)-5-hydroxy-2-pyridinyl]-2-cyclopropylethyl]-3-methoxy-5-(propyliminomethyl)benzamide |
| SMILES | CCC/N=C/c1cc(C(=O)NCC(c2cc(NCC)c(O)c(-c3ccnc(Cl)c3F)n2)C2CC2)cc(OC)c1N |
| InChI | InChI=1S/C29H34ClFN6O3/c1-4-9-33-14-18-11-17(12-23(40-3)25(18)32)29(39)36-15-20(16-6-7-16)21-13-22(34-5-2)27(38)26(37-21)19-8-10-35-28(30)24(19)31/h8,10-14,16,20,38H,4-7,9,15,32H2,1-3H3,(H,34,37)(H,36,39)/b33-14+ |
| InChIKey | YRCKSLZPFDBKTC-ZHSUKTGHSA-N |
| XLogP | 5.42 |
| TPSA | 134.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.08 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|