C30H44Br2O6 — CID 164911977
(2R,3R)-1,4-bis[3-bromo-5-tert-butyl-2-(ethoxymethoxy)phenyl]butane-2,3-diol (PubChem CID 164911977) has the molecular formula C30H44Br2O6 and a molecular weight of 660.48 g/mol. Its IUPAC name is (2R,3R)-1,4-bis[3-bromo-5-tert-butyl-2-(ethoxymethoxy)phenyl]butane-2,3-diol.
| Compound Name | (2R,3R)-1,4-bis[3-bromo-5-tert-butyl-2-(ethoxymethoxy)phenyl]butane-2,3-diol |
|---|---|
| PubChem CID | 164911977 |
| Molecular Formula | C30H44Br2O6 |
| Molecular Weight | 660.48 g/mol |
| Exact Mass | 658.15 |
| IUPAC Name | (2R,3R)-1,4-bis[3-bromo-5-tert-butyl-2-(ethoxymethoxy)phenyl]butane-2,3-diol |
| SMILES | CCOCOc1c(Br)cc(C(C)(C)C)cc1C[C@@H](O)[C@H](O)Cc1cc(C(C)(C)C)cc(Br)c1OCOCC |
| InChI | InChI=1S/C30H44Br2O6/c1-9-35-17-37-27-19(11-21(15-23(27)31)29(3,4)5)13-25(33)26(34)14-20-12-22(30(6,7)8)16-24(32)28(20)38-18-36-10-2/h11-12,15-16,25-26,33-34H,9-10,13-14,17-18H2,1-8H3/t25-,26-/m1/s1 |
| InChIKey | QIGPQASDFXBPSM-CLJLJLNGSA-N |
| XLogP | 7.06 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.48 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|