C40H50O4 — CID 164911986
2-[(2R,3R)-4-[2-hydroxy-3-(2,4,6-trimethylphenyl)phenyl]-2,3-di(propan-2-yloxy)butyl]-6-(2,4,6-trimethylphenyl)phenol (PubChem CID 164911986) has the molecular formula C40H50O4 and a molecular weight of 594.84 g/mol. Its IUPAC name is 2-[(2R,3R)-4-[2-hydroxy-3-(2,4,6-trimethylphenyl)phenyl]-2,3-di(propan-2-yloxy)butyl]-6-(2,4,6-trimethylphenyl)phenol.
| Compound Name | 2-[(2R,3R)-4-[2-hydroxy-3-(2,4,6-trimethylphenyl)phenyl]-2,3-di(propan-2-yloxy)butyl]-6-(2,4,6-trimethylphenyl)phenol |
|---|---|
| PubChem CID | 164911986 |
| Molecular Formula | C40H50O4 |
| Molecular Weight | 594.84 g/mol |
| Exact Mass | 594.37 |
| IUPAC Name | 2-[(2R,3R)-4-[2-hydroxy-3-(2,4,6-trimethylphenyl)phenyl]-2,3-di(propan-2-yloxy)butyl]-6-(2,4,6-trimethylphenyl)phenol |
| SMILES | Cc1cc(C)c(-c2cccc(C[C@@H](OC(C)C)[C@@H](Cc3cccc(-c4c(C)cc(C)cc4C)c3O)OC(C)C)c2O)c(C)c1 |
| InChI | InChI=1S/C40H50O4/c1-23(2)43-35(21-31-13-11-15-33(39(31)41)37-27(7)17-25(5)18-28(37)8)36(44-24(3)4)22-32-14-12-16-34(40(32)42)38-29(9)19-26(6)20-30(38)10/h11-20,23-24,35-36,41-42H,21-22H2,1-10H3/t35-,36-/m1/s1 |
| InChIKey | LGIJYFQCVKHUNO-LQFQNGICSA-N |
| XLogP | 9.65 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.84 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |