C12H9BrN4 — CID 164912175
5-bromo-12-methyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,6,9,11,13-hexaen-2-imine (PubChem CID 164912175) has the molecular formula C12H9BrN4 and a molecular weight of 289.14 g/mol. Its IUPAC name is 5-bromo-12-methyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,6,9,11,13-hexaen-2-imine.
| Compound Name | 5-bromo-12-methyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,6,9,11,13-hexaen-2-imine |
|---|---|
| PubChem CID | 164912175 |
| Molecular Formula | C12H9BrN4 |
| Molecular Weight | 289.14 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | 5-bromo-12-methyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,6,9,11,13-hexaen-2-imine |
| SMILES | [H]/N=c1/c2cc(Br)cnc2nc2cc(C)ccn12 |
| InChI | InChI=1S/C12H9BrN4/c1-7-2-3-17-10(4-7)16-12-9(11(17)14)5-8(13)6-15-12/h2-6,14H,1H3/b14-11- |
| InChIKey | TWHHHDNIKKNJMB-KAMYIIQDSA-N |
| XLogP | 2.43 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.14 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|