C22H35NOS — CID 164913374
(2E,4E,6E,8E)-N-(2-hydroxysulfanylethyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-amine (PubChem CID 164913374) has the molecular formula C22H35NOS and a molecular weight of 361.60 g/mol. Its IUPAC name is (2E,4E,6E,8E)-N-(2-hydroxysulfanylethyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-amine.
| Compound Name | (2E,4E,6E,8E)-N-(2-hydroxysulfanylethyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-amine |
|---|---|
| PubChem CID | 164913374 |
| Molecular Formula | C22H35NOS |
| Molecular Weight | 361.60 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | (2E,4E,6E,8E)-N-(2-hydroxysulfanylethyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-amine |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/CNCCSO)C(C)(C)CCC1 |
| InChI | InChI=1S/C22H35NOS/c1-18(8-6-9-19(2)13-15-23-16-17-25-24)11-12-21-20(3)10-7-14-22(21,4)5/h6,8-9,11-13,23-24H,7,10,14-17H2,1-5H3/b9-6+,12-11+,18-8+,19-13+ |
| InChIKey | IKGNZLYSVRHDKX-IRHGQBOFSA-N |
| XLogP | 6.31 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.60 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|