About [3,3-difluoro-1-(1-methyltriazol-4-yl)cyclobutyl]methanol
[3,3-difluoro-1-(1-methyltriazol-4-yl)cyclobutyl]methanol (PubChem CID 164913783) has the molecular formula C8H11F2N3O
and a molecular weight of 203.19 g/mol. Its IUPAC name is [3,3-difluoro-1-(1-methyltriazol-4-yl)cyclobutyl]methanol.
Molecular Properties
| Compound Name | [3,3-difluoro-1-(1-methyltriazol-4-yl)cyclobutyl]methanol |
| PubChem CID | 164913783 |
| Molecular Formula | C8H11F2N3O |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | [3,3-difluoro-1-(1-methyltriazol-4-yl)cyclobutyl]methanol |
| SMILES | Cn1cc(C2(CO)CC(F)(F)C2)nn1 |
| InChI | InChI=1S/C8H11F2N3O/c1-13-2-6(11-12-13)7(5-14)3-8(9,10)4-7/h2,14H,3-5H2,1H3 |
| InChIKey | GVLHQCBDUDLRDO-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3,3-difluoro-1-(1-methyltriazol-4-yl)cyclobutyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,3-difluoro-1-(1-methyltriazol-4-yl)cyclobutyl]methanol?
The IUPAC name of [3,3-difluoro-1-(1-methyltriazol-4-yl)cyclobutyl]methanol (CID 164913783) is [3,3-difluoro-1-(1-methyltriazol-4-yl)cyclobutyl]methanol.
What is the SMILES notation for [3,3-difluoro-1-(1-methyltriazol-4-yl)cyclobutyl]methanol?
The canonical SMILES for [3,3-difluoro-1-(1-methyltriazol-4-yl)cyclobutyl]methanol is Cn1cc(C2(CO)CC(F)(F)C2)nn1.
What is the InChIKey of [3,3-difluoro-1-(1-methyltriazol-4-yl)cyclobutyl]methanol?
The InChIKey is GVLHQCBDUDLRDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F2N3O/c1-13-2-6(11-12-13)7(5-14)3-8(9,10)4-7/h2,14H,3-5H2,1H3.
What are the key properties of [3,3-difluoro-1-(1-methyltriazol-4-yl)cyclobutyl]methanol?
[3,3-difluoro-1-(1-methyltriazol-4-yl)cyclobutyl]methanol has a molecular weight of 203.19 g/mol, XLogP of 0.47, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3,3-difluoro-1-(1-methyltriazol-4-yl)cyclobutyl]methanol is sourced from PubChem (CID 164913783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).