C13H19NO3S — CID 164914113
ethyl 4-[(E)-tert-butylsulfinyliminomethyl]cyclopenta-2,3-diene-1-carboxylate (PubChem CID 164914113) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is ethyl 4-[(E)-tert-butylsulfinyliminomethyl]cyclopenta-2,3-diene-1-carboxylate.
| Compound Name | ethyl 4-[(E)-tert-butylsulfinyliminomethyl]cyclopenta-2,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 164914113 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | ethyl 4-[(E)-tert-butylsulfinyliminomethyl]cyclopenta-2,3-diene-1-carboxylate |
| SMILES | CCOC(=O)C1C=C=C(/C=N/S(=O)C(C)(C)C)C1 |
| InChI | InChI=1S/C13H19NO3S/c1-5-17-12(15)11-7-6-10(8-11)9-14-18(16)13(2,3)4/h7,9,11H,5,8H2,1-4H3/b14-9+ |
| InChIKey | NANFKRWEALKJEM-NTEUORMPSA-N |
| XLogP | 2.18 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|