About ethyl formate;2-ethyl-4-phenoxy-6-prop-1-en-2-ylpyridazin-3-one
ethyl formate;2-ethyl-4-phenoxy-6-prop-1-en-2-ylpyridazin-3-one (PubChem CID 164914334) has the molecular formula C18H22N2O4
and a molecular weight of 330.38 g/mol. Its IUPAC name is ethyl formate;2-ethyl-4-phenoxy-6-prop-1-en-2-ylpyridazin-3-one.
Molecular Properties
| Compound Name | ethyl formate;2-ethyl-4-phenoxy-6-prop-1-en-2-ylpyridazin-3-one |
| PubChem CID | 164914334 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | ethyl formate;2-ethyl-4-phenoxy-6-prop-1-en-2-ylpyridazin-3-one |
| SMILES | C=C(C)c1cc(Oc2ccccc2)c(=O)n(CC)n1.CCOC=O |
| InChI | InChI=1S/C15H16N2O2.C3H6O2/c1-4-17-15(18)14(10-13(16-17)11(2)3)19-12-8-6-5-7-9-12;1-2-5-3-4/h5-10H,2,4H2,1,3H3;3H,2H2,1H3 |
| InChIKey | RRVFCWOICODPHO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethyl formate;2-ethyl-4-phenoxy-6-prop-1-en-2-ylpyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl formate;2-ethyl-4-phenoxy-6-prop-1-en-2-ylpyridazin-3-one?
The IUPAC name of ethyl formate;2-ethyl-4-phenoxy-6-prop-1-en-2-ylpyridazin-3-one (CID 164914334) is ethyl formate;2-ethyl-4-phenoxy-6-prop-1-en-2-ylpyridazin-3-one.
What is the SMILES notation for ethyl formate;2-ethyl-4-phenoxy-6-prop-1-en-2-ylpyridazin-3-one?
The canonical SMILES for ethyl formate;2-ethyl-4-phenoxy-6-prop-1-en-2-ylpyridazin-3-one is C=C(C)c1cc(Oc2ccccc2)c(=O)n(CC)n1.CCOC=O.
What is the InChIKey of ethyl formate;2-ethyl-4-phenoxy-6-prop-1-en-2-ylpyridazin-3-one?
The InChIKey is RRVFCWOICODPHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O2.C3H6O2/c1-4-17-15(18)14(10-13(16-17)11(2)3)19-12-8-6-5-7-9-12;1-2-5-3-4/h5-10H,2,4H2,1,3H3;3H,2H2,1H3.
What are the key properties of ethyl formate;2-ethyl-4-phenoxy-6-prop-1-en-2-ylpyridazin-3-one?
ethyl formate;2-ethyl-4-phenoxy-6-prop-1-en-2-ylpyridazin-3-one has a molecular weight of 330.38 g/mol, XLogP of 3.27, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl formate;2-ethyl-4-phenoxy-6-prop-1-en-2-ylpyridazin-3-one is sourced from PubChem (CID 164914334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).