C7H9F3N2O — CID 164914667
1-methyl-3-(2,2,2-trifluoroethyl)-2H-imidazole-4-carbaldehyde (PubChem CID 164914667) has the molecular formula C7H9F3N2O and a molecular weight of 194.16 g/mol. Its IUPAC name is 1-methyl-3-(2,2,2-trifluoroethyl)-2H-imidazole-4-carbaldehyde.
| Compound Name | 1-methyl-3-(2,2,2-trifluoroethyl)-2H-imidazole-4-carbaldehyde |
|---|---|
| PubChem CID | 164914667 |
| Molecular Formula | C7H9F3N2O |
| Molecular Weight | 194.16 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 1-methyl-3-(2,2,2-trifluoroethyl)-2H-imidazole-4-carbaldehyde |
| SMILES | CN1C=C(C=O)N(CC(F)(F)F)C1 |
| InChI | InChI=1S/C7H9F3N2O/c1-11-2-6(3-13)12(5-11)4-7(8,9)10/h2-3H,4-5H2,1H3 |
| InChIKey | HFCZXWKVPOWVAD-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.16 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|