C29H32ClN5O3 — CID 164914961
5-[2-[4-[(3-chloro-4-cyclopropyloxyphenyl)methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 164914961) has the molecular formula C29H32ClN5O3 and a molecular weight of 534.06 g/mol. Its IUPAC name is 5-[2-[4-[(3-chloro-4-cyclopropyloxyphenyl)methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[2-[4-[(3-chloro-4-cyclopropyloxyphenyl)methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 164914961 |
| Molecular Formula | C29H32ClN5O3 |
| Molecular Weight | 534.06 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | 5-[2-[4-[(3-chloro-4-cyclopropyloxyphenyl)methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)nc(NCCOCCCCNCc1ccc(OC3CC3)c(Cl)c1)c1ccncc12 |
| InChI | InChI=1S/C29H32ClN5O3/c30-25-15-19(3-8-27(25)38-21-5-6-21)17-32-10-1-2-13-37-14-12-34-29-23-9-11-33-18-24(23)22-7-4-20(28(31)36)16-26(22)35-29/h3-4,7-9,11,15-16,18,21,32H,1-2,5-6,10,12-14,17H2,(H2,31,36)(H,34,35) |
| InChIKey | DOXJZOCIJLRFLH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.06 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|