C29H30ClF3N4O4 — CID 164914980
5-[[1-[4-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]-2-methylpropan-2-yl]amino]benzo[c][2,6]naphthyridine-8-carboxylic acid (PubChem CID 164914980) has the molecular formula C29H30ClF3N4O4 and a molecular weight of 591.03 g/mol. Its IUPAC name is 5-[[1-[4-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]-2-methylpropan-2-yl]amino]benzo[c][2,6]naphthyridine-8-carboxylic acid.
| Compound Name | 5-[[1-[4-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]-2-methylpropan-2-yl]amino]benzo[c][2,6]naphthyridine-8-carboxylic acid |
|---|---|
| PubChem CID | 164914980 |
| Molecular Formula | C29H30ClF3N4O4 |
| Molecular Weight | 591.03 g/mol |
| Exact Mass | 590.19 |
| IUPAC Name | 5-[[1-[4-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]-2-methylpropan-2-yl]amino]benzo[c][2,6]naphthyridine-8-carboxylic acid |
| SMILES | CC(C)(COCCCCNCc1ccc(OC(F)(F)F)c(Cl)c1)Nc1nc2cc(C(=O)O)ccc2c2cnccc12 |
| InChI | InChI=1S/C29H30ClF3N4O4/c1-28(2,17-40-12-4-3-10-34-15-18-5-8-25(23(30)13-18)41-29(31,32)33)37-26-21-9-11-35-16-22(21)20-7-6-19(27(38)39)14-24(20)36-26/h5-9,11,13-14,16,34H,3-4,10,12,15,17H2,1-2H3,(H,36,37)(H,38,39) |
| InChIKey | ZZVAFDDAQGHPFE-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.03 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|