C30H31N5O3 — CID 164914998
5-[2-[4-[(3-cyano-4-cyclopropylphenyl)methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 164914998) has the molecular formula C30H31N5O3 and a molecular weight of 509.61 g/mol. Its IUPAC name is 5-[2-[4-[(3-cyano-4-cyclopropylphenyl)methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[2-[4-[(3-cyano-4-cyclopropylphenyl)methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 164914998 |
| Molecular Formula | C30H31N5O3 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | 5-[2-[4-[(3-cyano-4-cyclopropylphenyl)methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | N#Cc1cc(CNCCCCOCCOc2nc3cc(C(N)=O)ccc3c3cnccc23)ccc1C1CC1 |
| InChI | InChI=1S/C30H31N5O3/c31-17-23-15-20(3-7-24(23)21-4-5-21)18-33-10-1-2-12-37-13-14-38-30-26-9-11-34-19-27(26)25-8-6-22(29(32)36)16-28(25)35-30/h3,6-9,11,15-16,19,21,33H,1-2,4-5,10,12-14,18H2,(H2,32,36) |
| InChIKey | CKDCFGNOHLPEKW-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 123.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|