C29H29F3N6O2 — CID 164915004
5-[2-[4-[[3-(cyanomethyl)-5-(trifluoromethyl)phenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 164915004) has the molecular formula C29H29F3N6O2 and a molecular weight of 550.59 g/mol. Its IUPAC name is 5-[2-[4-[[3-(cyanomethyl)-5-(trifluoromethyl)phenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[2-[4-[[3-(cyanomethyl)-5-(trifluoromethyl)phenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 164915004 |
| Molecular Formula | C29H29F3N6O2 |
| Molecular Weight | 550.59 g/mol |
| Exact Mass | 550.23 |
| IUPAC Name | 5-[2-[4-[[3-(cyanomethyl)-5-(trifluoromethyl)phenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | N#CCc1cc(CNCCCCOCCNc2nc3cc(C(N)=O)ccc3c3cnccc23)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H29F3N6O2/c30-29(31,32)22-14-19(5-7-33)13-20(15-22)17-35-8-1-2-11-40-12-10-37-28-24-6-9-36-18-25(24)23-4-3-21(27(34)39)16-26(23)38-28/h3-4,6,9,13-16,18,35H,1-2,5,8,10-12,17H2,(H2,34,39)(H,37,38) |
| InChIKey | OHEVVEJVQNXGHF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.59 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|