C28H25F5N4O4 — CID 164915033
5-[3-[4-[[3,5-difluoro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]azetidin-1-yl]benzo[c][2,6]naphthyridine-8-carboxylic acid (PubChem CID 164915033) has the molecular formula C28H25F5N4O4 and a molecular weight of 576.52 g/mol. Its IUPAC name is 5-[3-[4-[[3,5-difluoro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]azetidin-1-yl]benzo[c][2,6]naphthyridine-8-carboxylic acid.
| Compound Name | 5-[3-[4-[[3,5-difluoro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]azetidin-1-yl]benzo[c][2,6]naphthyridine-8-carboxylic acid |
|---|---|
| PubChem CID | 164915033 |
| Molecular Formula | C28H25F5N4O4 |
| Molecular Weight | 576.52 g/mol |
| Exact Mass | 576.18 |
| IUPAC Name | 5-[3-[4-[[3,5-difluoro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]azetidin-1-yl]benzo[c][2,6]naphthyridine-8-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)nc(N1CC(OCCCCNCc3cc(F)c(OC(F)(F)F)c(F)c3)C1)c1ccncc12 |
| InChI | InChI=1S/C28H25F5N4O4/c29-22-9-16(10-23(30)25(22)41-28(31,32)33)12-34-6-1-2-8-40-18-14-37(15-18)26-20-5-7-35-13-21(20)19-4-3-17(27(38)39)11-24(19)36-26/h3-5,7,9-11,13,18,34H,1-2,6,8,12,14-15H2,(H,38,39) |
| InChIKey | KPKJNCKJNAZTGG-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.52 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|