C28H27F5N4O4 — CID 164915041
5-[[(2R)-1-[4-[[3,5-difluoro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]propan-2-yl]amino]benzo[c][2,6]naphthyridine-8-carboxylic acid (PubChem CID 164915041) has the molecular formula C28H27F5N4O4 and a molecular weight of 578.54 g/mol. Its IUPAC name is 5-[[(2R)-1-[4-[[3,5-difluoro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]propan-2-yl]amino]benzo[c][2,6]naphthyridine-8-carboxylic acid.
| Compound Name | 5-[[(2R)-1-[4-[[3,5-difluoro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]propan-2-yl]amino]benzo[c][2,6]naphthyridine-8-carboxylic acid |
|---|---|
| PubChem CID | 164915041 |
| Molecular Formula | C28H27F5N4O4 |
| Molecular Weight | 578.54 g/mol |
| Exact Mass | 578.20 |
| IUPAC Name | 5-[[(2R)-1-[4-[[3,5-difluoro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]propan-2-yl]amino]benzo[c][2,6]naphthyridine-8-carboxylic acid |
| SMILES | C[C@H](COCCCCNCc1cc(F)c(OC(F)(F)F)c(F)c1)Nc1nc2cc(C(=O)O)ccc2c2cnccc12 |
| InChI | InChI=1S/C28H27F5N4O4/c1-16(36-26-20-6-8-35-14-21(20)19-5-4-18(27(38)39)12-24(19)37-26)15-40-9-3-2-7-34-13-17-10-22(29)25(23(30)11-17)41-28(31,32)33/h4-6,8,10-12,14,16,34H,2-3,7,9,13,15H2,1H3,(H,36,37)(H,38,39)/t16-/m1/s1 |
| InChIKey | OYICKRPKZVEBNG-MRXNPFEDSA-N |
| XLogP | 6.05 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.54 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|