C28H28FN5O3 — CID 164915045
5-[2-[4-[[3-(cyanomethyl)-5-fluorophenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxylic acid (PubChem CID 164915045) has the molecular formula C28H28FN5O3 and a molecular weight of 501.56 g/mol. Its IUPAC name is 5-[2-[4-[[3-(cyanomethyl)-5-fluorophenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxylic acid.
| Compound Name | 5-[2-[4-[[3-(cyanomethyl)-5-fluorophenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxylic acid |
|---|---|
| PubChem CID | 164915045 |
| Molecular Formula | C28H28FN5O3 |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | 5-[2-[4-[[3-(cyanomethyl)-5-fluorophenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxylic acid |
| SMILES | N#CCc1cc(F)cc(CNCCCCOCCNc2nc3cc(C(=O)O)ccc3c3cnccc23)c1 |
| InChI | InChI=1S/C28H28FN5O3/c29-22-14-19(5-7-30)13-20(15-22)17-31-8-1-2-11-37-12-10-33-27-24-6-9-32-18-25(24)23-4-3-21(28(35)36)16-26(23)34-27/h3-4,6,9,13-16,18,31H,1-2,5,8,10-12,17H2,(H,33,34)(H,35,36) |
| InChIKey | GGHCFHXCBYOKTF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|