C29H31F3N4O6 — CID 164915087
5-[2-[4-[[3-(2-hydroxyethoxy)-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 164915087) has the molecular formula C29H31F3N4O6 and a molecular weight of 588.58 g/mol. Its IUPAC name is 5-[2-[4-[[3-(2-hydroxyethoxy)-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[2-[4-[[3-(2-hydroxyethoxy)-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 164915087 |
| Molecular Formula | C29H31F3N4O6 |
| Molecular Weight | 588.58 g/mol |
| Exact Mass | 588.22 |
| IUPAC Name | 5-[2-[4-[[3-(2-hydroxyethoxy)-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)nc(OCCOCCCCNCc1cc(OCCO)cc(OC(F)(F)F)c1)c1ccncc12 |
| InChI | InChI=1S/C29H31F3N4O6/c30-29(31,32)42-22-14-19(13-21(16-22)40-10-8-37)17-34-6-1-2-9-39-11-12-41-28-24-5-7-35-18-25(24)23-4-3-20(27(33)38)15-26(23)36-28/h3-5,7,13-16,18,34,37H,1-2,6,8-12,17H2,(H2,33,38) |
| InChIKey | MMVVQQWBXCXNQP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 138.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.58 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|