C28H28F3N3O6 — CID 164915105
5-[2-[4-[[3-methoxy-4-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxylic acid (PubChem CID 164915105) has the molecular formula C28H28F3N3O6 and a molecular weight of 559.54 g/mol. Its IUPAC name is 5-[2-[4-[[3-methoxy-4-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxylic acid.
| Compound Name | 5-[2-[4-[[3-methoxy-4-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxylic acid |
|---|---|
| PubChem CID | 164915105 |
| Molecular Formula | C28H28F3N3O6 |
| Molecular Weight | 559.54 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | 5-[2-[4-[[3-methoxy-4-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxylic acid |
| SMILES | COc1cc(CNCCCCOCCOc2nc3cc(C(=O)O)ccc3c3cnccc23)ccc1OC(F)(F)F |
| InChI | InChI=1S/C28H28F3N3O6/c1-37-25-14-18(4-7-24(25)40-28(29,30)31)16-32-9-2-3-11-38-12-13-39-26-21-8-10-33-17-22(21)20-6-5-19(27(35)36)15-23(20)34-26/h4-8,10,14-15,17,32H,2-3,9,11-13,16H2,1H3,(H,35,36) |
| InChIKey | MXKUOZKGRRIYDM-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 112.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.54 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|