C30H28F3N5O3 — CID 164915140
5-[3-[4-[[3-(cyanomethyl)-5-(trifluoromethyl)phenyl]methylamino]butoxy]azetidin-1-yl]benzo[c][2,6]naphthyridine-8-carboxylic acid (PubChem CID 164915140) has the molecular formula C30H28F3N5O3 and a molecular weight of 563.58 g/mol. Its IUPAC name is 5-[3-[4-[[3-(cyanomethyl)-5-(trifluoromethyl)phenyl]methylamino]butoxy]azetidin-1-yl]benzo[c][2,6]naphthyridine-8-carboxylic acid.
| Compound Name | 5-[3-[4-[[3-(cyanomethyl)-5-(trifluoromethyl)phenyl]methylamino]butoxy]azetidin-1-yl]benzo[c][2,6]naphthyridine-8-carboxylic acid |
|---|---|
| PubChem CID | 164915140 |
| Molecular Formula | C30H28F3N5O3 |
| Molecular Weight | 563.58 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | 5-[3-[4-[[3-(cyanomethyl)-5-(trifluoromethyl)phenyl]methylamino]butoxy]azetidin-1-yl]benzo[c][2,6]naphthyridine-8-carboxylic acid |
| SMILES | N#CCc1cc(CNCCCCOC2CN(c3nc4cc(C(=O)O)ccc4c4cnccc34)C2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H28F3N5O3/c31-30(32,33)22-12-19(5-7-34)11-20(13-22)15-35-8-1-2-10-41-23-17-38(18-23)28-25-6-9-36-16-26(25)24-4-3-21(29(39)40)14-27(24)37-28/h3-4,6,9,11-14,16,23,35H,1-2,5,8,10,15,17-18H2,(H,39,40) |
| InChIKey | OJAHYTKDTIYGRY-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.58 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|