C30H30F3N3O5 — CID 164915151
5-[2-[4-[[3-cyclopropyl-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxylic acid (PubChem CID 164915151) has the molecular formula C30H30F3N3O5 and a molecular weight of 569.58 g/mol. Its IUPAC name is 5-[2-[4-[[3-cyclopropyl-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxylic acid.
| Compound Name | 5-[2-[4-[[3-cyclopropyl-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxylic acid |
|---|---|
| PubChem CID | 164915151 |
| Molecular Formula | C30H30F3N3O5 |
| Molecular Weight | 569.58 g/mol |
| Exact Mass | 569.21 |
| IUPAC Name | 5-[2-[4-[[3-cyclopropyl-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)nc(OCCOCCCCNCc1cc(OC(F)(F)F)cc(C3CC3)c1)c1ccncc12 |
| InChI | InChI=1S/C30H30F3N3O5/c31-30(32,33)41-23-14-19(13-22(15-23)20-3-4-20)17-34-8-1-2-10-39-11-12-40-28-25-7-9-35-18-26(25)24-6-5-21(29(37)38)16-27(24)36-28/h5-7,9,13-16,18,20,34H,1-4,8,10-12,17H2,(H,37,38) |
| InChIKey | QIYSFZUFUMZRFH-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 102.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.58 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|