C28H27F3N6O3 — CID 164915159
5-[2-[4-[[3-cyano-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 164915159) has the molecular formula C28H27F3N6O3 and a molecular weight of 552.56 g/mol. Its IUPAC name is 5-[2-[4-[[3-cyano-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[2-[4-[[3-cyano-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 164915159 |
| Molecular Formula | C28H27F3N6O3 |
| Molecular Weight | 552.56 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | 5-[2-[4-[[3-cyano-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | N#Cc1cc(CNCCCCOCCNc2nc3cc(C(N)=O)ccc3c3cnccc23)cc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C28H27F3N6O3/c29-28(30,31)40-21-12-18(15-32)11-19(13-21)16-34-6-1-2-9-39-10-8-36-27-23-5-7-35-17-24(23)22-4-3-20(26(33)38)14-25(22)37-27/h3-5,7,11-14,17,34H,1-2,6,8-10,16H2,(H2,33,38)(H,36,37) |
| InChIKey | LUKCVJMSEKMIBS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 135.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.56 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|