C32H31F3N4O5 — CID 164915160
5-[2-[4-[[3-(furan-3-ylmethyl)-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 164915160) has the molecular formula C32H31F3N4O5 and a molecular weight of 608.62 g/mol. Its IUPAC name is 5-[2-[4-[[3-(furan-3-ylmethyl)-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[2-[4-[[3-(furan-3-ylmethyl)-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 164915160 |
| Molecular Formula | C32H31F3N4O5 |
| Molecular Weight | 608.62 g/mol |
| Exact Mass | 608.22 |
| IUPAC Name | 5-[2-[4-[[3-(furan-3-ylmethyl)-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)nc(OCCOCCCCNCc1cc(Cc3ccoc3)cc(OC(F)(F)F)c1)c1ccncc12 |
| InChI | InChI=1S/C32H31F3N4O5/c33-32(34,35)44-25-15-22(13-21-6-10-42-20-21)14-23(16-25)18-37-7-1-2-9-41-11-12-43-31-27-5-8-38-19-28(27)26-4-3-24(30(36)40)17-29(26)39-31/h3-6,8,10,14-17,19-20,37H,1-2,7,9,11-13,18H2,(H2,36,40) |
| InChIKey | PFQVXAZAEYOJAK-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 121.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.62 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|