C28H28F3N3O5 — CID 164915166
5-[2-[4-[[3-methyl-4-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxylic acid (PubChem CID 164915166) has the molecular formula C28H28F3N3O5 and a molecular weight of 543.54 g/mol. Its IUPAC name is 5-[2-[4-[[3-methyl-4-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxylic acid.
| Compound Name | 5-[2-[4-[[3-methyl-4-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxylic acid |
|---|---|
| PubChem CID | 164915166 |
| Molecular Formula | C28H28F3N3O5 |
| Molecular Weight | 543.54 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | 5-[2-[4-[[3-methyl-4-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxylic acid |
| SMILES | Cc1cc(CNCCCCOCCOc2nc3cc(C(=O)O)ccc3c3cnccc23)ccc1OC(F)(F)F |
| InChI | InChI=1S/C28H28F3N3O5/c1-18-14-19(4-7-25(18)39-28(29,30)31)16-32-9-2-3-11-37-12-13-38-26-22-8-10-33-17-23(22)21-6-5-20(27(35)36)15-24(21)34-26/h4-8,10,14-15,17,32H,2-3,9,11-13,16H2,1H3,(H,35,36) |
| InChIKey | CRHJUMKCZAOJLP-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 102.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.54 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|