C31H32F3N7O3 — CID 164915187
5-[2-[4-[[3-(imidazol-1-ylmethyl)-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 164915187) has the molecular formula C31H32F3N7O3 and a molecular weight of 607.64 g/mol. Its IUPAC name is 5-[2-[4-[[3-(imidazol-1-ylmethyl)-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[2-[4-[[3-(imidazol-1-ylmethyl)-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 164915187 |
| Molecular Formula | C31H32F3N7O3 |
| Molecular Weight | 607.64 g/mol |
| Exact Mass | 607.25 |
| IUPAC Name | 5-[2-[4-[[3-(imidazol-1-ylmethyl)-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)nc(NCCOCCCCNCc1cc(Cn3ccnc3)cc(OC(F)(F)F)c1)c1ccncc12 |
| InChI | InChI=1S/C31H32F3N7O3/c32-31(33,34)44-24-14-21(13-22(15-24)19-41-10-8-38-20-41)17-36-6-1-2-11-43-12-9-39-30-26-5-7-37-18-27(26)25-4-3-23(29(35)42)16-28(25)40-30/h3-5,7-8,10,13-16,18,20,36H,1-2,6,9,11-12,17,19H2,(H2,35,42)(H,39,40) |
| InChIKey | FZYDRVDEQBODTG-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 129.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.64 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|