C29H27F3N4O5 — CID 164915188
5-[2-[4-[[3-(cyanomethyl)-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxylic acid (PubChem CID 164915188) has the molecular formula C29H27F3N4O5 and a molecular weight of 568.55 g/mol. Its IUPAC name is 5-[2-[4-[[3-(cyanomethyl)-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxylic acid.
| Compound Name | 5-[2-[4-[[3-(cyanomethyl)-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxylic acid |
|---|---|
| PubChem CID | 164915188 |
| Molecular Formula | C29H27F3N4O5 |
| Molecular Weight | 568.55 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | 5-[2-[4-[[3-(cyanomethyl)-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxylic acid |
| SMILES | N#CCc1cc(CNCCCCOCCOc2nc3cc(C(=O)O)ccc3c3cnccc23)cc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C29H27F3N4O5/c30-29(31,32)41-22-14-19(5-7-33)13-20(15-22)17-34-8-1-2-10-39-11-12-40-27-24-6-9-35-18-25(24)23-4-3-21(28(37)38)16-26(23)36-27/h3-4,6,9,13-16,18,34H,1-2,5,8,10-12,17H2,(H,37,38) |
| InChIKey | DITIJPXRAGWNLI-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 126.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.55 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|