C27H28FN3O5 — CID 164915221
5-[2-[4-[[3-fluoro-5-(hydroxymethyl)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxylic acid (PubChem CID 164915221) has the molecular formula C27H28FN3O5 and a molecular weight of 493.54 g/mol. Its IUPAC name is 5-[2-[4-[[3-fluoro-5-(hydroxymethyl)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxylic acid.
| Compound Name | 5-[2-[4-[[3-fluoro-5-(hydroxymethyl)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxylic acid |
|---|---|
| PubChem CID | 164915221 |
| Molecular Formula | C27H28FN3O5 |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 5-[2-[4-[[3-fluoro-5-(hydroxymethyl)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)nc(OCCOCCCCNCc1cc(F)cc(CO)c1)c1ccncc12 |
| InChI | InChI=1S/C27H28FN3O5/c28-21-12-18(11-19(13-21)17-32)15-29-6-1-2-8-35-9-10-36-26-23-5-7-30-16-24(23)22-4-3-20(27(33)34)14-25(22)31-26/h3-5,7,11-14,16,29,32H,1-2,6,8-10,15,17H2,(H,33,34) |
| InChIKey | OXUHZNGGQZYPHE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 113.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|