C28H28ClF3N4O4 — CID 164915222
5-[(2S)-1-[4-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]propan-2-yl]oxybenzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 164915222) has the molecular formula C28H28ClF3N4O4 and a molecular weight of 577.00 g/mol. Its IUPAC name is 5-[(2S)-1-[4-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]propan-2-yl]oxybenzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[(2S)-1-[4-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]propan-2-yl]oxybenzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 164915222 |
| Molecular Formula | C28H28ClF3N4O4 |
| Molecular Weight | 577.00 g/mol |
| Exact Mass | 576.18 |
| IUPAC Name | 5-[(2S)-1-[4-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]propan-2-yl]oxybenzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | C[C@@H](COCCCCNCc1ccc(OC(F)(F)F)c(Cl)c1)Oc1nc2cc(C(N)=O)ccc2c2cnccc12 |
| InChI | InChI=1S/C28H28ClF3N4O4/c1-17(16-38-11-3-2-9-34-14-18-4-7-25(23(29)12-18)40-28(30,31)32)39-27-21-8-10-35-15-22(21)20-6-5-19(26(33)37)13-24(20)36-27/h4-8,10,12-13,15,17,34H,2-3,9,11,14,16H2,1H3,(H2,33,37)/t17-/m0/s1 |
| InChIKey | JWARDYDEHQOHAV-KRWDZBQOSA-N |
| XLogP | 5.79 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.00 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|